ChemNet > CAS > 85199-06-0 2,5-Dimethylbenzeneboronic acid
85199-06-0 2,5-Dimethylbenzeneboronic acid
produktnavn |
2,5-Dimethylbenzeneboronic acid |
Synonymer |
2,5-Dimethylphenylboronic acid; P-XYLENE-2-BORONIC ACID |
Molekylær Formel |
C8H11BO2 |
Molekylvekt |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-6-3-4-7(2)8(5-6)9(10)11/h3-5,10-11H,1-2H3 |
CAS-nummer |
85199-06-0 |
Molecular Structure |
|
Tetthet |
1.07g/cm3 |
Smeltepunkt |
186-191℃ |
Kokepunkt |
305.1°C at 760 mmHg |
Brytningsindeks |
1.523 |
Flammepunktet |
138.3°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|