ChemNet > CAS > 881-86-7 Dimethyl 2,5-pyridinedicarboxylate
881-86-7 Dimethyl 2,5-pyridinedicarboxylate
produktnavn |
Dimethyl 2,5-pyridinedicarboxylate |
Synonymer |
Dimethyl pyridine-2,5-dicarboxylate; Dimethyl isocinchomeronate; Pyridine-2,5-dicarboxylic acid dimethyl ester; Dimethyl-2,5-pyridinecarboxylate |
Molekylær Formel |
C9H9NO4 |
Molekylvekt |
195.1721 |
InChI |
InChI=1/C9H9NO4/c1-13-8(11)6-3-4-7(10-5-6)9(12)14-2/h3-5H,1-2H3 |
CAS-nummer |
881-86-7 |
Molecular Structure |
|
Tetthet |
1.231g/cm3 |
Smeltepunkt |
213-217℃ |
Kokepunkt |
302.9°C at 760 mmHg |
Brytningsindeks |
1.516 |
Flammepunktet |
137°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|