942-92-7 Hexanophenone
produktnavn |
Hexanophenone |
Engelsk navn |
Hexanophenone; n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
Molekylær Formel |
C12H16O |
Molekylvekt |
176.2548 |
InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
CAS-nummer |
942-92-7 |
EINECS |
213-394-6 |
Molecular Structure |
|
Tetthet |
0.942g/cm3 |
Smeltepunkt |
25-26℃ |
Kokepunkt |
265°C at 760 mmHg |
Brytningsindeks |
1.498 |
Flammepunktet |
105.5°C |
Damptrykk |
0.0094mmHg at 25°C |
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|