ChemNet > CAS > 95883-10-6 2,5-Dimethylcinnamic acid
95883-10-6 2,5-Dimethylcinnamic acid
| produktnavn |
2,5-Dimethylcinnamic acid |
| Synonymer |
(2E)-3-(2,5-dimethylphenyl)prop-2-enoic acid |
| Molekylær Formel |
C11H12O2 |
| Molekylvekt |
176.2118 |
| InChI |
InChI=1/C11H12O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+ |
| CAS-nummer |
95883-10-6 |
| Molecular Structure |
|
| Tetthet |
1.118g/cm3 |
| Kokepunkt |
307°C at 760 mmHg |
| Brytningsindeks |
1.592 |
| Flammepunktet |
212.2°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
