103-30-0 trans-Stilbene
Nazwa produktu: |
trans-Stilbene |
Angielska nazwa |
trans-Stilbene; trans-1,1-(1,2-Ethenediyl)bis(benzene); 1,1'-ethene-1,1-diyldibenzene; 1,1'-(E)-ethene-1,2-diyldibenzene; 1,1'-(Z)-ethene-1,2-diyldibenzene |
MF |
C14H12 |
Masie cząsteczkowej |
180.2451 |
InChI |
InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
Nr CAS |
103-30-0 |
EINECS |
203-098-5 |
Struktury molekularnej |
|
Gęstość |
1.044g/cm3 |
Temperatura topnienia |
122-126℃ |
Temperatura wrzenia |
307°C at 760 mmHg |
Współczynnik załamania |
1.658 |
Temperatura zapłonu |
128.5°C |
Ciśnienie pary |
0.00135mmHg at 25°C |
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|