ChemNet > CAS > 122033-54-9 4-Bromo-2,3,5,6-tetrafluorobenzoylchloride
122033-54-9 4-Bromo-2,3,5,6-tetrafluorobenzoylchloride
Nazwa produktu: |
4-Bromo-2,3,5,6-tetrafluorobenzoylchloride |
Synonimy |
4-Bromo-2,3,5,6-tetrafluorobenzoyl chloride |
MF |
C7BrClF4O |
Masie cząsteczkowej |
291.4249 |
InChI |
InChI=1/C7BrClF4O/c8-2-5(12)3(10)1(7(9)14)4(11)6(2)13 |
Nr CAS |
122033-54-9 |
Struktury molekularnej |
|
Gęstość |
1.957g/cm3 |
Temperatura wrzenia |
216.5°C at 760 mmHg |
Współczynnik załamania |
1.505 |
Temperatura zapłonu |
84.8°C |
Symbole zagrożenia |
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|