ChemNet > CAS > 1468-82-2 2-bromo-1-(3-thienyl)-1-ethanone
1468-82-2 2-bromo-1-(3-thienyl)-1-ethanone
| Nazwa produktu: |
2-bromo-1-(3-thienyl)-1-ethanone |
| Synonimy |
2-bromo-1-thiophen-3-ylethanone |
| MF |
C6H5BrOS |
| Masie cząsteczkowej |
205.0723 |
| InChI |
InChI=1/C6H5BrOS/c7-3-6(8)5-1-2-9-4-5/h1-2,4H,3H2 |
| Nr CAS |
1468-82-2 |
| Struktury molekularnej |
|
| Gęstość |
1.658g/cm3 |
| Temperatura topnienia |
62℃ |
| Temperatura wrzenia |
247.5°C at 760 mmHg |
| Współczynnik załamania |
1.601 |
| Temperatura zapłonu |
103.5°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
