ChemNet > CAS > 151411-98-2 2,4,6-Trifluorobenzyl bromide
151411-98-2 2,4,6-Trifluorobenzyl bromide
Nazwa produktu: |
2,4,6-Trifluorobenzyl bromide |
Synonimy |
alpha-Bromo-2,4,6-trifluorotoluene; 2-(bromomethyl)-1,3,5-trifluorobenzene |
MF |
C7H4BrF3 |
Masie cząsteczkowej |
225.0059 |
InChI |
InChI=1/C7H4BrF3/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2 |
Nr CAS |
151411-98-2 |
Struktury molekularnej |
|
Gęstość |
1.71g/cm3 |
Temperatura wrzenia |
177.4°C at 760 mmHg |
Współczynnik załamania |
1.502 |
Temperatura zapłonu |
66.1°C |
Symbole zagrożenia |
|
Kody ryzyka |
R34:Causes burns.;
R36:Irritating to eyes.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|