ChemNet > CAS > 157373-08-5 2,3,4-trifluorobenzoyl chloride
157373-08-5 2,3,4-trifluorobenzoyl chloride
Nazwa produktu: |
2,3,4-trifluorobenzoyl chloride |
MF |
C7H2ClF3O |
Masie cząsteczkowej |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H |
Nr CAS |
157373-08-5 |
Struktury molekularnej |
|
Gęstość |
1.514g/cm3 |
Temperatura wrzenia |
203.2°C at 760 mmHg |
Współczynnik załamania |
1.479 |
Temperatura zapłonu |
60.4°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|