ChemNet > CAS > 15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
Nazwa produktu: |
octanoic acid, compound with dicyclohexylamine (1:1) |
Synonimy |
Octanoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine caprylate; N-cyclohexylcyclohexanaminium octanoate |
MF |
C20H39NO2 |
Masie cząsteczkowej |
325.5292 |
InChI |
InChI=1/C12H23N.C8H16O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7-8(9)10/h11-13H,1-10H2;2-7H2,1H3,(H,9,10) |
Nr CAS |
15816-71-4 |
EINECS |
239-914-1 |
Struktury molekularnej |
|
Temperatura wrzenia |
466.8°C at 760 mmHg |
Temperatura zapłonu |
236.1°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
|
|