18031-40-8;2111-75-3 L(-)-Perillaldehyde
Nazwa produktu: |
L(-)-Perillaldehyde |
Angielska nazwa |
L(-)-Perillaldehyde; L-4(1-Methylethenyl)-1-cyclohexene-1-carboxaldehyde; (-)-Perillaaldehyde; 1-methoxy-2,3,5-trimethylbenzene; (4S)-4-(1-methylethenyl)cyclohex-1-ene-1-carbaldehyde; (-)-Perillaldehyde; L-perillaldehyde; ; 4-isopropenylcyclohex-1-enecarbaldehyde; 4-(prop-1-en-2-yl)cyclohex-1-ene-1-carbaldehyde; Perilla aldehyde |
MF |
C10H14O |
Masie cząsteczkowej |
150.2176 |
InChI |
InChI=1/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3/t10-/m1/s1 |
Nr CAS |
18031-40-8;2111-75-3 |
EINECS |
243-843-1;218-302-8 |
Struktury molekularnej |
|
Gęstość |
1.002g/cm3 |
Temperatura wrzenia |
238°C at 760 mmHg |
Współczynnik załamania |
1.543 |
Temperatura zapłonu |
95.6°C |
Ciśnienie pary |
0.0434mmHg at 25°C |
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|