ChemNet > CAS > 261762-39-4 2-Chloro-3,6-difluorobenzaldehyde
261762-39-4 2-Chloro-3,6-difluorobenzaldehyde
Nazwa produktu: |
2-Chloro-3,6-difluorobenzaldehyde |
Angielska nazwa |
2-Chloro-3,6-difluorobenzaldehyde; |
MF |
C7H3ClF2O |
Masie cząsteczkowej |
176.5479 |
InChI |
InChI=1/C7H3ClF2O/c8-7-4(3-11)5(9)1-2-6(7)10/h1-3H |
Nr CAS |
261762-39-4 |
Struktury molekularnej |
|
Gęstość |
1.453g/cm3 |
Temperatura topnienia |
46-50℃ |
Temperatura wrzenia |
206.4°C at 760 mmHg |
Współczynnik załamania |
1.536 |
Temperatura zapłonu |
78.6°C |
Ciśnienie pary |
0.238mmHg at 25°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|