ChemNet > CAS > 34231-78-2 Acetoxybenzaldehyde; 97%
34231-78-2 Acetoxybenzaldehyde; 97%
Nazwa produktu: |
Acetoxybenzaldehyde; 97% |
Synonimy |
3-Acetoxybenzaldehyde; 3-Formylphenyl acetate |
MF |
C9H8O3 |
Masie cząsteczkowej |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-3-8(5-9)6-10/h2-6H,1H3 |
Nr CAS |
34231-78-2 |
EINECS |
251-890-4 |
Struktury molekularnej |
|
Gęstość |
1.183g/cm3 |
Temperatura wrzenia |
271.6°C at 760 mmHg |
Współczynnik załamania |
1.552 |
Temperatura zapłonu |
117.6°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|