ChemNet > CAS > 3678-70-4 Diphenyl-2-pyridylmethane
3678-70-4 Diphenyl-2-pyridylmethane
Nazwa produktu: |
Diphenyl-2-pyridylmethane |
Angielska nazwa |
Diphenyl-2-pyridylmethane; 2-Diphenylmethylpyridine; 2-benzhydrylpyridine |
MF |
C18H15N |
Masie cząsteczkowej |
245.3184 |
InChI |
InChI=1/C18H15N/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17/h1-14,18H |
Nr CAS |
3678-70-4 |
EINECS |
222-953-3 |
Struktury molekularnej |
|
Gęstość |
1.085g/cm3 |
Temperatura topnienia |
58-61℃ |
Temperatura wrzenia |
359.8°C at 760 mmHg |
Współczynnik załamania |
1.607 |
Temperatura zapłonu |
153.6°C |
Ciśnienie pary |
4.81E-05mmHg at 25°C |
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|