ChemNet > CAS > 3696-22-8 1-(4-nitrophenyl)-2-thiourea
3696-22-8 1-(4-nitrophenyl)-2-thiourea
Nazwa produktu: |
1-(4-nitrophenyl)-2-thiourea |
Synonimy |
4-Nitrophenylthiourea; 1-(4-nitrophenyl)thiourea |
MF |
C7H7N3O2S |
Masie cząsteczkowej |
197.2144 |
InChI |
InChI=1/C7H7N3O2S/c8-7(13)9-5-1-3-6(4-2-5)10(11)12/h1-4H,(H3,8,9,13) |
Nr CAS |
3696-22-8 |
EINECS |
223-021-9 |
Struktury molekularnej |
|
Gęstość |
1.524g/cm3 |
Temperatura topnienia |
206℃ |
Temperatura wrzenia |
365.5°C at 760 mmHg |
Współczynnik załamania |
1.759 |
Temperatura zapłonu |
174.9°C |
Symbole zagrożenia |
|
Kody ryzyka |
R25:Toxic if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|