CAS No: 38411-25-5, Chemical Name: 2,2',3,3',4,5,6'-heptachlorobiphenyl
the physical and chemical property of 38411-25-5, 2,2',3,3',4,5,6'-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 38411-25-5 2,2',3,3',4,5,6'-heptachlorobiphenyl
38411-25-5 2,2',3,3',4,5,6'-heptachlorobiphenyl
Nazwa produktu: |
2,2',3,3',4,5,6'-heptachlorobiphenyl |
Synonimy |
1,1'-biphenyl, 2,2',3,3',4,5,6'-heptachloro-; 2,2',3,3',4,5,6'-HEPTACHLOROBIPHENYL; 2,2',3,3',4,5,6'-PCB; 38411-25-5 |
MF |
C12H3Cl7 |
Masie cząsteczkowej |
395.3232 |
InChI |
InChI=1/C12H3Cl7/c13-5-1-2-6(14)10(17)8(5)4-3-7(15)11(18)12(19)9(4)16/h1-3H |
Nr CAS |
38411-25-5 |
Struktury molekularnej |
|
Gęstość |
1.658g/cm3 |
Temperatura wrzenia |
411.8°C at 760 mmHg |
Współczynnik załamania |
1.632 |
Temperatura zapłonu |
201.6°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
|
|