ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
Nazwa produktu: |
3,5-Dichlorophenylhydrazine |
Angielska nazwa |
3,5-Dichlorophenylhydrazine; |
MF |
C6H6Cl2N2 |
Masie cząsteczkowej |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
Nr CAS |
39943-56-1 |
Struktury molekularnej |
|
Gęstość |
1.475g/cm3 |
Temperatura wrzenia |
286.1°C at 760 mmHg |
Współczynnik załamania |
1.665 |
Temperatura zapłonu |
126.8°C |
Ciśnienie pary |
0.0027mmHg at 25°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|