ChemNet > CAS > 465514-80-1 1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone
465514-80-1 1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone
Nazwa produktu: |
1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone |
Synonimy |
1-(3-fluorophenyl)-2-(3-methoxyphenyl)ethanone |
MF |
C15H13FO2 |
Masie cząsteczkowej |
244.2609 |
InChI |
InChI=1/C15H13FO2/c1-18-14-7-2-4-11(8-14)9-15(17)12-5-3-6-13(16)10-12/h2-8,10H,9H2,1H3 |
Nr CAS |
465514-80-1 |
Struktury molekularnej |
|
Gęstość |
1.163g/cm3 |
Temperatura wrzenia |
367.4°C at 760 mmHg |
Współczynnik załamania |
1.555 |
Temperatura zapłonu |
170°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|