ChemNet > CAS > 59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
Nazwa produktu: |
4-methyl-1,2,3-thiadiazole-5-carbonyl chloride |
MF |
C4H3ClN2OS |
Masie cząsteczkowej |
162.5974 |
InChI |
InChI=1/C4H3ClN2OS/c1-2-3(4(5)8)9-7-6-2/h1H3 |
Nr CAS |
59944-65-9 |
Struktury molekularnej |
|
Gęstość |
1.504g/cm3 |
Temperatura wrzenia |
239.9°C at 760 mmHg |
Współczynnik załamania |
1.578 |
Temperatura zapłonu |
98.9°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|