ChemNet > CAS > 62476-62-4 Alpha,Alpha,2-Trichloro-6-fluorotoluene
62476-62-4 Alpha,Alpha,2-Trichloro-6-fluorotoluene
| Nazwa produktu: |
Alpha,Alpha,2-Trichloro-6-fluorotoluene |
| Synonimy |
2-Chloro-6-fluorobenzalchloride; 1-chloro-2-(dichloromethyl)-3-fluorobenzene |
| MF |
C7H4Cl3F |
| Masie cząsteczkowej |
213.4641 |
| InChI |
InChI=1/C7H4Cl3F/c8-4-2-1-3-5(11)6(4)7(9)10/h1-3,7H |
| Nr CAS |
62476-62-4 |
| EINECS |
263-562-8 |
| Struktury molekularnej |
|
| Gęstość |
1.467g/cm3 |
| Temperatura wrzenia |
225.4°C at 760 mmHg |
| Współczynnik załamania |
1.541 |
| Temperatura zapłonu |
99.7°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
