ChemNet > CAS > 75-39-8 Acetaldehyde ammonia trimer
75-39-8 Acetaldehyde ammonia trimer
| Nazwa produktu: |
Acetaldehyde ammonia trimer |
| Synonimy |
Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| MF |
C2H7NO |
| Masie cząsteczkowej |
61.0831 |
| InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| Nr CAS |
75-39-8 |
| EINECS |
200-868-2 |
| Struktury molekularnej |
|
| Gęstość |
0.967g/cm3 |
| Temperatura topnienia |
95-97℃ |
| Temperatura wrzenia |
113.8°C at 760 mmHg |
| Współczynnik załamania |
1.431 |
| Temperatura zapłonu |
22.7°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
