85-29-0 2,4'-Dichlorobenzophenone
| Nazwa produktu: |
2,4'-Dichlorobenzophenone |
| Angielska nazwa |
2,4'-Dichlorobenzophenone; Dichlorobenzophenone |
| MF |
C13H8Cl2O |
| Masie cząsteczkowej |
251.11 |
| InChI |
InChI=1/C13H8Cl2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H |
| Nr CAS |
85-29-0 |
| EINECS |
201-596-7 |
| Struktury molekularnej |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|