ChemNet > CAS > 90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
Nazwa produktu: |
2-Hydroxy-4,6-dimethoxyacetophenone |
Synonimy |
xanthoxylin |
MF |
C10H12O4 |
Masie cząsteczkowej |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
Nr CAS |
90-24-4 |
EINECS |
201-978-3 |
Struktury molekularnej |
|
Gęstość |
1.172g/cm3 |
Temperatura topnienia |
80-82℃ |
Temperatura wrzenia |
355.1°C at 760 mmHg |
Współczynnik załamania |
1.527 |
Temperatura zapłonu |
141.2°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|