ChemNet > CAS > 9003-53-6 Poly(styrene)
9003-53-6 Poly(styrene)
Nazwa produktu: |
Poly(styrene) |
Synonimy |
Polystyrene; polystyrene standard 4000000; polystyrene standard 2000000; polystyrene standard 300000; polystyrene standard 1000000; polystyrene standard 700000; polystyrene standard 650000; polystyrene standard 2200000 certi-fied acc. to din; polystyrene standard 500000; polystyrene standard 8000000; Polystyrene (General Purpose Grade); Polystyrene, dicarboxy terminated; Polystyrene, methacrylate terminated solution; Styrene Resin (High M.Wt.); Styrene Latex; Styrene Resin (Low M.Wt.); Styrene Resin (Med.M.Wt.); Styrene-divinylbenzene copolymer (20% cross-linked); Polystyrene2% crosslinked with vinylbenzene; EPS; Expandable Polystyrene |
MF |
C8H8 |
Masie cząsteczkowej |
104.1491 |
InChI |
InChI=1/C9H8/c1-8(2)9-6-4-3-5-7-9/h1-8H |
Nr CAS |
9003-53-6 |
Struktury molekularnej |
|
Gęstość |
1.047 |
Temperatura wrzenia |
212℃ |
Współczynnik załamania |
1.5916 |
Rozpuszczalność w wodzie |
insoluble |
Symbole zagrożenia |
Xi:;
|
Kody ryzyka |
41:;
|
Bezpieczeństwo opis |
S24/25:;
|
|