99-20-7 D-Trehalose anhydrous
Nazwa produktu: |
D-Trehalose anhydrous |
Angielska nazwa |
D-Trehalose anhydrous; Trehalose; alpha-D-Trehalose; alpha-D-glucopyranosyl alpha-D-glucopyranoside; Trehalose; D(+)Trehalose; D-(+)-Trehalose; α-L-glucopyranosyl; α-D-glucopyranoside; Trehalose anhydrous |
MF |
C12H22O11 |
Masie cząsteczkowej |
342.2965 |
InChI |
InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
Nr CAS |
99-20-7 |
EINECS |
202-739-6 |
Struktury molekularnej |
|
Gęstość |
1.76g/cm3 |
Temperatura topnienia |
214-216℃ |
Temperatura wrzenia |
675.4°C at 760 mmHg |
Współczynnik załamania |
1.652 |
Temperatura zapłonu |
362.3°C |
Ciśnienie pary |
3.87E-21mmHg at 25°C |
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|