ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
| Nome do produto |
3,5-Dibromobenzeneboronic acid |
| Sinônimos |
3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
| Fórmula molecular |
C6H5BBr2O2 |
| Peso Molecular |
279.7217 |
| InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
| CAS Registry Number |
117695-55-3 |
| Estrutura Molecular |
|
| Densidade |
2.09g/cm3 |
| Ponto de fusão |
300℃ |
| Ponto de ebulição |
382.8°C at 760 mmHg |
| índice de refração |
1.651 |
| O ponto de inflamação |
185.3°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
