ChemNet > CAS > 120-61-6 Dimethyl terephthalate
120-61-6 Dimethyl terephthalate
| Nome do produto |
Dimethyl terephthalate |
| Sinônimos |
D.M.T.; Terephthalic acid dimethyl ester; Benzene-1,4-dicarboxylic acid dimethyl ester; Terephthalic acid dimethyl ester; dimethyl cyclohexane-1,4-dicarboxylate; 1,3-benzodioxol-5-yl methylcarbamate; dimethyl benzene-1,4-dicarboxylate; 4-(methoxycarbonyl)benzoic acid; dimethyl benzene-1,2-dicarboxylate; DMT |
| Fórmula molecular |
C10H10O4 |
| Peso Molecular |
194.184 |
| InChI |
InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
| CAS Registry Number |
120-61-6 |
| EINECS |
204-411-8 |
| Estrutura Molecular |
|
| Densidade |
1.175g/cm3 |
| Ponto de fusão |
140-143℃ |
| Ponto de ebulição |
282.7°C at 760 mmHg |
| índice de refração |
1.514 |
| O ponto de inflamação |
146.7°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
