ChemNet > CAS > 20474-93-5 Allyl crotonate
20474-93-5 Allyl crotonate
| Nome do produto |
Allyl crotonate |
| Sinônimos |
Crotonic acid allyl ester; prop-2-en-1-yl but-2-enoate; prop-2-en-1-yl (2E)-but-2-enoate |
| Fórmula molecular |
C7H10O2 |
| Peso Molecular |
126.1531 |
| InChI |
InChI=1/C7H10O2/c1-3-5-7(8)9-6-4-2/h3-5H,2,6H2,1H3/b5-3+ |
| CAS Registry Number |
20474-93-5 |
| EINECS |
243-845-2 |
| Estrutura Molecular |
|
| Densidade |
0.925g/cm3 |
| Ponto de ebulição |
151.3°C at 760 mmHg |
| índice de refração |
1.441 |
| O ponto de inflamação |
50.7°C |
| Símbolos de perigo |
|
| Códigos de risco |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
