ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
| Nome do produto |
3-(trifluoromethyl)phenoxyacetonitrile |
| Sinônimos |
2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
| Fórmula molecular |
C8H7FO3 |
| Peso Molecular |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
| CAS Registry Number |
2145-31-5 |
| Estrutura Molecular |
|
| Densidade |
1.309g/cm3 |
| Ponto de ebulição |
268.9°C at 760 mmHg |
| índice de refração |
1.526 |
| O ponto de inflamação |
116.4°C |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S36/37:Wear suitable protective clothing and gloves.;
|
|
