ChemNet > CAS > 2396-84-1 ethyl sorbate
2396-84-1 ethyl sorbate
| Nome do produto |
ethyl sorbate |
| Sinônimos |
Ethyl 2,4-hexadienoate~Sorbic acid ethyl ester; (E,E)-2,4-Hexadienoic acid ethylester; Ethyl trans,trans-2,4-hexadienoate; ethyl hexa-2,4-dienoate; ethyl (2E,4E)-hexa-2,4-dienoate; ethyl (2Z,4Z)-hexa-2,4-dienoate |
| Fórmula molecular |
C8H12O2 |
| Peso Molecular |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3,5-7H,4H2,1-2H3/b5-3-,7-6- |
| CAS Registry Number |
2396-84-1 |
| EINECS |
219-258-2 |
| Estrutura Molecular |
|
| Densidade |
0.926g/cm3 |
| Ponto de ebulição |
195.5°C at 760 mmHg |
| índice de refração |
1.454 |
| O ponto de inflamação |
69.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
