ChemNet > CAS > 24623-20-9 6-methyl-1-indanone
24623-20-9 6-methyl-1-indanone
| Nome do produto |
6-methyl-1-indanone |
| Sinônimos |
6-methyl-2,3-dihydro-1H-inden-1-one |
| Fórmula molecular |
C10H10O |
| Peso Molecular |
146.1858 |
| InChI |
InChI=1/C10H10O/c1-7-2-3-8-4-5-10(11)9(8)6-7/h2-3,6H,4-5H2,1H3 |
| CAS Registry Number |
24623-20-9 |
| Estrutura Molecular |
|
| Densidade |
1.113g/cm3 |
| Ponto de fusão |
60-62℃ |
| Ponto de ebulição |
265.1°C at 760 mmHg |
| índice de refração |
1.574 |
| O ponto de inflamação |
109.9°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
