ChemNet > CAS > 2497-91-8 2-Chloro-3,5-dinitrobenzoic acid
2497-91-8 2-Chloro-3,5-dinitrobenzoic acid
| Nome do produto |
2-Chloro-3,5-dinitrobenzoic acid |
| Sinônimos |
2-C-3,5-DNBA; 2-chloro-3,5-dinitrobenzoate |
| Fórmula molecular |
C7H2ClN2O6 |
| Peso Molecular |
245.5541 |
| InChI |
InChI=1/C7H3ClN2O6/c8-6-4(7(11)12)1-3(9(13)14)2-5(6)10(15)16/h1-2H,(H,11,12)/p-1 |
| CAS Registry Number |
2497-91-8 |
| EINECS |
219-684-9 |
| Estrutura Molecular |
|
| Ponto de fusão |
196-199℃ |
| Ponto de ebulição |
408.3°C at 760 mmHg |
| O ponto de inflamação |
200.8°C |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
