ChemNet > CAS > 31545-26-3 4-Cloro-3-nitrofenil ciclopropil cetona
31545-26-3 4-Cloro-3-nitrofenil ciclopropil cetona
| Nome do produto |
4-Cloro-3-nitrofenil ciclopropil cetona |
| Sinônimos |
(4-cloro-3-nitrofenil) (ciclopropil)metanona |
| Nome em inglês |
4-Chloro-3-nitrophenyl cyclopropyl ketone;(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
| Fórmula molecular |
C10H8ClNO3 |
| Peso Molecular |
225.6284 |
| InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
| CAS Registry Number |
31545-26-3 |
| EINECS |
250-690-4 |
| Estrutura Molecular |
|
| Densidade |
1.464g/cm3 |
| Ponto de fusão |
78-80℃ |
| Ponto de ebulição |
333.4°C at 760 mmHg |
| índice de refração |
1.631 |
| O ponto de inflamação |
155.4°C |
| Pressão de vapor |
0.000137mmHg at 25°C |
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|