ChemNet > CAS > 4731-53-7 Tri-n-octylphosphine
4731-53-7 Tri-n-octylphosphine
| Nome do produto |
Tri-n-octylphosphine |
| Sinônimos |
Phosphine, trioctyl-; Trioctylphosphine; trioctylphosphane; Trioctyl phosphine |
| Fórmula molecular |
C24H51P |
| Peso Molecular |
370.6355 |
| InChI |
InChI=1/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| CAS Registry Number |
4731-53-7 |
| EINECS |
225-234-2 |
| Estrutura Molecular |
|
| Ponto de ebulição |
445°C at 760 mmHg |
| O ponto de inflamação |
236°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
