ChemNet > CAS > 61-47-2 Serotonin creatinine sulfate monohydrate
61-47-2 Serotonin creatinine sulfate monohydrate
| Nome do produto |
Serotonin creatinine sulfate monohydrate |
| Sinônimos |
5-Hydroxytryptamine creatinine sulfate monohydrate; 2-(2-aminoethyl)indole-5-ol 2-imino-1-methylimidazoline-4-one sulphate; 2-amino-1-methyl-4-oxo-4,5-dihydro-1H-imidazol-1-ium 2-(5-hydroxy-1H-indol-3-yl)ethanaminium sulfate (1:1:1); 3-(2-aminoethyl)-1H-indol-5-ol; 2-amino-1-methyl-5H-imidazol-4-one; sulfuric acid; hydrate; 2-(5-hydroxy-1H-indol-3-yl)ethanaminium |
| Fórmula molecular |
C10H13N2O |
| Peso Molecular |
177.2225 |
| InChI |
InChI=1/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/p+1 |
| CAS Registry Number |
61-47-2 |
| EINECS |
213-539-3 |
| Estrutura Molecular |
|
| Ponto de fusão |
216-219℃ |
| Ponto de ebulição |
416.1°C at 760 mmHg |
| O ponto de inflamação |
205.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
R40:Possible risks of irreversible effects.;
|
| Descrição da Segurança |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
