ChemNet > CAS > 87-05-8 7-Ethoxy-4-methylcoumarin
87-05-8 7-Ethoxy-4-methylcoumarin
| Nome do produto |
7-Ethoxy-4-methylcoumarin |
| Sinônimos |
7-Ethoxy-4-methyl-2H-chromen-2-one; Ethyl 4-methylumbelliferyl ether |
| Fórmula molecular |
C12H12O3 |
| Peso Molecular |
204.2219 |
| InChI |
InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
| CAS Registry Number |
87-05-8 |
| EINECS |
201-721-5 |
| Estrutura Molecular |
|
| Densidade |
1.163g/cm3 |
| Ponto de fusão |
113-114℃ |
| Ponto de ebulição |
351.4°C at 760 mmHg |
| índice de refração |
1.548 |
| O ponto de inflamação |
146.2°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
