ChemNet > CAS > 158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
| Название продукта |
4-Amino-3-chloro-5-methylbenzonitrile |
| Синонимы |
2-Chloro-4-cyano-6-methylaniline |
| Молекулярная формула |
C8H7ClN2 |
| Молекулярный вес |
166.6076 |
| InChI |
InChI=1/C8H7ClN2/c1-5-2-6(4-10)3-7(9)8(5)11/h2-3H,11H2,1H3 |
| Регистрационный номер CAS |
158296-69-6 |
| Молекулярная структура |
|
| Плотность |
1.27g/cm3 |
| Точка кипения |
302°C at 760 mmHg |
| Показатель преломления |
1.594 |
| Температура вспышки |
136.5°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
