ChemNet > CAS > 2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
Название продукта |
4-Chloro-alpha-methylphenylacetonitrile |
Синонимы |
2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
Молекулярная формула |
C9H8ClN |
Молекулярный вес |
165.6195 |
InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
Регистрационный номер CAS |
2184-88-5 |
EINECS |
218-569-0 |
Молекулярная структура |
|
Плотность |
1.143g/cm3 |
Точка кипения |
260.3°C at 760 mmHg |
Показатель преломления |
1.537 |
Температура вспышки |
104°C |
Символы опасности |
|
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Характеристики безопасности |
S36/37:Wear suitable protective clothing and gloves.;
|
|