ChemNet > CAS > 2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
| Название продукта |
4-Chloro-alpha-methylphenylacetonitrile |
| Синонимы |
2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
| Молекулярная формула |
C9H8ClN |
| Молекулярный вес |
165.6195 |
| InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
| Регистрационный номер CAS |
2184-88-5 |
| EINECS |
218-569-0 |
| Молекулярная структура |
|
| Плотность |
1.143g/cm3 |
| Точка кипения |
260.3°C at 760 mmHg |
| Показатель преломления |
1.537 |
| Температура вспышки |
104°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S36/37:Wear suitable protective clothing and gloves.;
|
|
