ChemNet > CAS > 2210-28-8 n-Propyl methacrylate
2210-28-8 n-Propyl methacrylate
| Название продукта |
n-Propyl methacrylate |
| Синонимы |
n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
| Молекулярная формула |
C7H12O2 |
| Молекулярный вес |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
| Регистрационный номер CAS |
2210-28-8 |
| EINECS |
218-639-0 |
| Молекулярная структура |
|
| Плотность |
0.899g/cm3 |
| Точка кипения |
141°C at 760 mmHg |
| Показатель преломления |
1.416 |
| Температура вспышки |
34.7°C |
| Символы опасности |
|
| Риск коды |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
