ChemNet > CAS > 2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
Название продукта |
Trimethyl 1,3,5-benzenetricarboxylate |
Синонимы |
Trimethyl benzene-1,3,5-tricarboxylate; Trimethyl Trimesate; 1,3,5-Benzenetricarboxylic acid trimethyl ester; benzene-1,3,5-triyl triacetate; trimethyl cyclohexane-1,3,5-tricarboxylate |
Молекулярная формула |
C12H18O6 |
Молекулярный вес |
258.2677 |
InChI |
InChI=1/C12H18O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h7-9H,4-6H2,1-3H3 |
Регистрационный номер CAS |
2672-58-4 |
EINECS |
220-215-5 |
Молекулярная структура |
|
Плотность |
1.177g/cm3 |
Температура плавления |
144-147℃ |
Точка кипения |
332.8°C at 760 mmHg |
Показатель преломления |
1.464 |
Температура вспышки |
144.1°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|