ChemNet > CAS > 344-14-9 dimethyl fluoromalonate
344-14-9 dimethyl fluoromalonate
| Название продукта |
dimethyl fluoromalonate |
| Синонимы |
Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester |
| Молекулярная формула |
C5H7FO4 |
| Молекулярный вес |
150.1051 |
| InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| Регистрационный номер CAS |
344-14-9 |
| Молекулярная структура |
|
| Плотность |
1.211g/cm3 |
| Точка кипения |
140.3°C at 760 mmHg |
| Показатель преломления |
1.382 |
| Температура вспышки |
38.4°C |
| Символы опасности |
|
| Риск коды |
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
