ChemNet > CAS > 5312-97-0 2,5-Dimethoxybenzonitrile
5312-97-0 2,5-Dimethoxybenzonitrile
Название продукта |
2,5-Dimethoxybenzonitrile |
Английское название |
2,5-Dimethoxybenzonitrile;3-{3-methoxy-4-[(3-methylbenzyl)oxy]phenyl}-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
Молекулярная формула |
C26H23N3O2 |
Молекулярный вес |
409.4797 |
InChI |
InChI=1/C26H23N3O2/c1-17-5-4-6-20(11-17)16-31-24-10-8-19(14-25(24)30-3)13-21(15-27)26-28-22-9-7-18(2)12-23(22)29-26/h4-14H,16H2,1-3H3,(H,28,29) |
Регистрационный номер CAS |
5312-97-0 |
EINECS |
226-169-2 |
Молекулярная структура |
|
Плотность |
1.23g/cm3 |
Температура плавления |
80-82℃ |
Точка кипения |
638°C at 760 mmHg |
Показатель преломления |
1.672 |
Температура вспышки |
339.6°C |
Давление пара |
3.55E-16mmHg at 25°C |
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|