ChemNet > CAS > 5785-66-0 Cyclopropyl diphenyl carbinol
5785-66-0 Cyclopropyl diphenyl carbinol
Название продукта |
Cyclopropyl diphenyl carbinol |
Синонимы |
alpha-Cyclopropylbenzhydrol~Cyclopropyl diphenyl carbinol; Cyclopropyldiphenylmethanol; alpha-cyclopropylbenzhydryl alcohol; N-[(1E)-(4-methoxyphenyl)methylidene]-3,5-dimethyl-4H-1,2,4-triazol-4-amine |
Молекулярная формула |
C12H14N4O |
Молекулярный вес |
230.2658 |
InChI |
InChI=1/C12H14N4O/c1-9-14-15-10(2)16(9)13-8-11-4-6-12(17-3)7-5-11/h4-8H,1-3H3/b13-8+ |
Регистрационный номер CAS |
5785-66-0 |
EINECS |
227-312-1 |
Молекулярная структура |
|
Плотность |
1.16g/cm3 |
Температура плавления |
82-85℃ |
Точка кипения |
419°C at 760 mmHg |
Показатель преломления |
1.59 |
Температура вспышки |
207.2°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|