CAS No: 68629-07-2, Chemical Name: 2,6,10,15,19,23-hexamethyltetracosene
the physical and chemical property of 68629-07-2, 2,6,10,15,19,23-hexamethyltetracosene is provided by ChemNet.com
ChemNet > CAS > 68629-07-2 2,6,10,15,19,23-hexamethyltetracosene
68629-07-2 2,6,10,15,19,23-hexamethyltetracosene
Название продукта |
2,6,10,15,19,23-hexamethyltetracosene |
Синонимы |
2,6,10,15,19,23-Hexamethyltetracosene; Pentahydrosqualene; Tetracosene, 2,6,10,15,19,23-hexamethyl-; (7E)-2,6,10,15,19,23-hexamethyltetracos-7-ene; 2,6,10,15,19,23-hexamethyltetracos-1-ene |
Молекулярная формула |
C30H60 |
Молекулярный вес |
420.7974 |
InChI |
InChI=1/C30H60/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h26-30H,1,9-24H2,2-8H3 |
Регистрационный номер CAS |
68629-07-2 |
EINECS |
271-913-1 |
Молекулярная структура |
|
Плотность |
0.808g/cm3 |
Точка кипения |
476.5°C at 760 mmHg |
Показатель преломления |
1.451 |
Температура вспышки |
238.2°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
|
|