ChemNet > CAS > 7469-83-2 1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid
7469-83-2 1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid
| Название продукта |
1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid |
| Синонимы |
2-(4-Chlorophenyl)-2-methylpropionic acid; 1-(4-methoxyphenyl)cyclohexanecarboxylic acid; 1-(4-methoxyphenyl)cyclohexanecarboxylate |
| Молекулярная формула |
C14H17O3 |
| Молекулярный вес |
233.2835 |
| InChI |
InChI=1/C14H18O3/c1-17-12-7-5-11(6-8-12)14(13(15)16)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3,(H,15,16)/p-1 |
| Регистрационный номер CAS |
7469-83-2 |
| EINECS |
231-266-8 |
| Молекулярная структура |
|
| Температура плавления |
172-177℃ |
| Точка кипения |
389.7°C at 760 mmHg |
| Температура вспышки |
145.8°C |
| Символы опасности |
|
| Риск коды |
|
| Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|
