ChemNet > CAS > 79-35-6 1,1-dichloro-2,2-difluoroethylene
79-35-6 1,1-dichloro-2,2-difluoroethylene
Название продукта |
1,1-dichloro-2,2-difluoroethylene |
Английское название |
1,1-dichloro-2,2-difluoroethylene; FC-1112a; 1-chloro-1,2,2-trifluoroethene |
Молекулярная формула |
C2Cl2F2 |
Молекулярный вес |
132.9242 |
InChI |
InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
Регистрационный номер CAS |
79-35-6 |
EINECS |
201-198-3 |
Молекулярная структура |
|
Плотность |
1.503g/cm3 |
Точка кипения |
17.3°C at 760 mmHg |
Показатель преломления |
1.392 |
Давление пара |
999mmHg at 25°C |
Риск коды |
R23:Toxic by inhalation.;
R36/38:Irritating to eyes and skin.;
|
Характеристики безопасности |
S23:Do not inhale gas/fumes/vapour/spray.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S9:Keep container in a well-ventilated place.;
|
|