ChemNet > CAS > 938-95-4 DL-2-(4-chlorophenyl)propan-oic acid
938-95-4 DL-2-(4-chlorophenyl)propan-oic acid
| Название продукта |
DL-2-(4-chlorophenyl)propan-oic acid |
| Английское название |
DL-2-(4-chlorophenyl)propan-oic acid; 4-chloromethyl phenylacetic acid; 2-(4-chlorophenyl)propanoic acid; [4-(chloromethyl)phenyl]acetic acid; 2-(4-chlorophenyl)propionic acid |
| Молекулярная формула |
C9H9ClO2 |
| Молекулярный вес |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c10-6-8-3-1-7(2-4-8)5-9(11)12/h1-4H,5-6H2,(H,11,12) |
| Регистрационный номер CAS |
938-95-4 |
| EINECS |
213-351-1 |
| Молекулярная структура |
|
| Плотность |
1.277g/cm3 |
| Точка кипения |
332.2°C at 760 mmHg |
| Показатель преломления |
1.565 |
| Температура вспышки |
154.7°C |
| Давление пара |
5.91E-05mmHg at 25°C |
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|