101-99-5 N-Phenylurethane
اسم المنتج |
N-Phenylurethane |
الاسم بالانجليزية |
N-Phenylurethane; Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
الصيغة الجزيئية |
C9H11NO2 |
الوزن الجزيئي الغرامي |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
إستراتيجية المساعدة القطرية |
101-99-5 |
المفوضية الأوروبية رقم |
202-995-9 |
بنية جزيئية |
|
كثافة |
1.136g/cm3 |
نقطة الغليان |
238°C at 760 mmHg |
معامل الإنكسار |
1.558 |
نقطة الوميض |
79.2°C |
ضغط البخار |
0.0434mmHg at 25°C |
خطر المصطلحات |
R40:Possible risks of irreversible effects.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|