ChemNet > CAS > 10534-89-1 Hexaaminecobalt(III) chloride
10534-89-1 Hexaaminecobalt(III) chloride
| اسم المنتج |
Hexaaminecobalt(III) chloride |
| الاسم المستعار |
Hexaamine cobalt(III) chloride; hexamminecobalttrichloride; Hexaamminecobalt (III) chloride; Hexamminecobalt(III) chloride; hexaamminecobalt trichloride; Hexaamminecobaltchlorideorangepowder; cobalt(3+) chloride ammoniate (1:3:6); azanide; cobalt |
| الصيغة الجزيئية |
C6H12ClCoN4 |
| الوزن الجزيئي الغرامي |
234.5719 |
| InChI |
InChI=1/C6H12N4.ClH.Co/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1-6H2;1H;/q;;+2/p-1 |
| إستراتيجية المساعدة القطرية |
10534-89-1 |
| المفوضية الأوروبية رقم |
234-103-9 |
| بنية جزيئية |
|
| درجة الإنصهار |
217℃ |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|
