ChemNet > CAS > 1141-23-7 3-(4-Chlorophenyl)glutaramic acid
1141-23-7 3-(4-Chlorophenyl)glutaramic acid
اسم المنتج |
3-(4-Chlorophenyl)glutaramic acid |
الاسم المستعار |
3-(4-Chloro phenyl) Glutaric acid monoamide; 5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid; β-(4-chlorophenyl)Glutarimide |
الصيغة الجزيئية |
C11H12ClNO3 |
الوزن الجزيئي الغرامي |
241.6709 |
InChI |
InChI=1/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16) |
إستراتيجية المساعدة القطرية |
1141-23-7 |
بنية جزيئية |
|
كثافة |
1.343g/cm3 |
نقطة الغليان |
494.9°C at 760 mmHg |
معامل الإنكسار |
1.578 |
نقطة الوميض |
253.1°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|